This compound is a glutamic acid derivative featuring a tert-butyl ester protecting group on the side chain carboxyl. It is primarily used as a research reagent in peptide synthesis and biochemical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2419-56-9
Di-tert-butyl Glutamate Hydrochloride
Pharmaceutical intermediate for peptide synthesis
TERT-BUTYL (4S)-4-AMINO-4-CARBAMOYLBUTANOATE HYDROCHLORIDE
Peptide synthesis intermediate
Methyl 4-acetamido-5-chloro-2-hydroxybenzoate
pharmaceutical intermediate
(10E,12Z)-10,12-Octadecadienoic acid
analytical reference standard for CLA research
2-Amino-3,5-dibromopyrazine
Research compound for chemical synthesis
(S)-1-tert-Butyl 5-methyl 2-((tert-butoxycarbonyl)amino)pentanedioate
research compound
(2S)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid
OIOAKXPMBIZAHL-LURJTMIESA-N
CC(C)(C)OC(=O)CC[C@@H](C(=O)O)N