(10E,12Z)-10,12-Octadecadienoic acid is a conjugated linoleic acid isomer used primarily as an analytical reference standard in research. It is a fatty acid characterized by a specific configuration of conjugated double bonds and a carboxylic acid group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2420-56-6
Potassium N-Cocoyl Glycinate
Surfactant in personal care products
Palmitoleic acid
monounsaturated fatty acid
Nervonic acid
monounsaturated fatty acid
Oleic acid
textile processing and metal extraction
2-Amino-3,5-dibromopyrazine
Research compound for chemical synthesis
(S)-1-tert-Butyl 5-methyl 2-((tert-butoxycarbonyl)amino)pentanedioate
research compound
2-Bromo-3-thiophenecarboxylic acid
research reagent
Nadide phosphate disodium
biochemical research reagent
(10E,12Z)-octadeca-10,12-dienoic acid
GKJZMAHZJGSBKD-NMMTYZSQSA-N
CCCCC/C=C\C=C\CCCCCCCCC(=O)O