Di-tert-butyl Glutamate Hydrochloride is a salt-like derivative of glutamic acid in which both carboxyl groups are protected by tert-butyl esters. It is primarily used as a building block in solid-phase peptide synthesis, where the protecting groups allow selective formation of peptide bonds without unwanted side reactions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Di-tert-butyl Glutamate Hydrochloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
5-tert-Butyl 1-methyl L-glutamate hydrochloride
amino acid derivative building block
TERT-BUTYL (4S)-4-AMINO-4-CARBAMOYLBUTANOATE HYDROCHLORIDE
Peptide synthesis intermediate
H-Glu-OtBu.HCl
Peptide synthesis building block
(2S)-2-amino-5-(tert-butoxy)-5-oxopentanoic acid
research compound
4-amino-3-(trifluoromethyl)benzonitrile
Pharmaceutical intermediate for bicalutamide synthesis
4-Chloro-3-(trifluoromethyl)phenyl isocyanate
Pharmaceutical intermediate
3,5-Bis(trifluoromethyl)benzyl alcohol
Pharmaceutical intermediate for synthesis
4-(2-OXO-2,3-DIHYDRO-1H-BENZIMIDAZOL-1-YL)BUTANOIC ACID
pharmaceutical intermediate
ditert-butyl (2S)-2-aminopentanedioate;hydrochloride
LFEYMWCCUAOUKZ-FVGYRXGTSA-N
CC(C)(C)OC(=O)CC[C@@H](C(=O)OC(C)(C)C)N.Cl
Di-tert-butyl Glutamate Hydrochloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.