This compound is a research reagent featuring a pyrrole ring with a 2-fluorophenyl substituent and a tetrahydropyridinylsulfonyl group. It is used primarily in laboratory settings for scientific investigation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2416241-97-7
(2S)-2-amino-5-(tert-butoxy)-5-oxopentanoic acid
research compound
Methyl 4-acetamido-5-chloro-2-hydroxybenzoate
pharmaceutical intermediate
(10E,12Z)-10,12-Octadecadienoic acid
analytical reference standard for CLA research
2-Amino-3,5-dibromopyrazine
Research compound for chemical synthesis
1-[5-(2-fluorophenyl)-1-(1,2,3,4-tetrahydropyridin-5-ylsulfonyl)pyrrol-3-yl]-N-methylmethanamine
RCEKCXIQEZNULR-UHFFFAOYSA-N
CNCC1=CN(C(=C1)C2=CC=CC=C2F)S(=O)(=O)C3=CNCCC3