2,3,6-Trifluorobenzoic acid is a fluorinated aromatic carboxylic acid commonly used as a research reagent in organic synthesis. Its structure features a benzene ring substituted with three fluorine atoms and a carboxylic acid group, making it a building block for preparing more complex molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2358-29-4
(S)-tert-Butyl 4-amino-3,3-difluoropyrrolidine-1-carboxylate
Research reagent for chemical synthesis
Tert-Butyl diethylphosphonoacetate
Research reagent for chemical synthesis
1,2-oxazole-3-carboxylic Acid
Research reagent for chemical synthesis
(3-Iodophenyl)methanesulfonyl chloride
Research reagent for chemical synthesis
3,5-diiodopyridin-2-amine
research compound
(2S)-2-[[(2R,3R)-3-[(2S)-1-[(3R,4S,5S)-4-[[(2S)-2-[[(2S)-2-[3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl-methylamino]-3-methylbutanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methoxy-5-methylheptanoyl]pyrrolidin-2-yl]-3-methoxy-2-methylpropanoyl]amino]-3-phenylpropanoic acid
ADC research reagent
2-dimethylphosphoryl-4-phenyl-aniline
research compound
4-Bromo-2-methylphenol
research compound
2,3,6-trifluorobenzoic acid
MGUPHQGQNHDGNK-UHFFFAOYSA-N
C1=CC(=C(C(=C1F)C(=O)O)F)F