Ni(phen)Cl2 is a coordination compound consisting of nickel(II) chloride and 1,10-phenanthroline. It is primarily used as a research reagent in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Ni(phen)cl2 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Tris(1,10-phenanthroline)cobalt(III) Tris(hexafluorophosphate)
Reference standard for electrochemical studies
Bis(2-(2,4-difluorobenzene-6-id-1-yl)-5-fluoropyridine);iridium(3+);1,10-phenanthroline;hexafluorophosphate
OLED material or light-emitting component
Tris(1,10-phenanthroline)cobalt(II) Bis(hexafluorophosphate)
research compound
(PHEN)NIBR2
ligand coordinated nickel complex
4-Bromotoluene-d7
Deuterated analytical reference standard
MAC glucuronide linker-2
antibody-drug conjugate linker reagent
1,7-Phenanthroline
research compound
MPTP hydrochloride
research compound
dichloronickel;1,10-phenanthroline
RMTGLTCLJRSHSB-UHFFFAOYSA-L
C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.Cl[Ni]Cl
Ni(phen)cl2 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.