(2,6-Dimethoxypyridin-3-yl)boronic acid is a boronic acid derivative used as a chemical reagent in organic synthesis. Its structure features a pyridine ring with two methoxy substituents and a boronic acid group, contributing to its utility in cross-coupling reactions and related research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2,6-dimethoxypyridin-3-yl)boronic Acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Fluoropyridine
chemical reagent for organic synthesis
2,6-Dichlorobenzenesulfonyl chloride
chemical reagent for organic synthesis
1-ethynyl-4-(trifluoromethyl)benzene
chemical reagent for organic synthesis
2-Hydroxyestradiol-d5
research compound
(8R,9S,13S,14S,17S)-16,16,17-Trideuterio-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,4,17-triol
deuterated internal standard
2-{[(4-fluorophenyl)methyl]amino}ethan-1-ol
Research compound
5H-Pyrazolo[4,3-c]pyridine-5-carboxylic acid, 3-amino-2-(4-fluoro-3,5-dimethylphenyl)-2,4,6,7-tetrahydro-4-methyl-, 1,1-dimethylethyl ester, (4S)
research compound
(2,6-dimethoxy-3-pyridinyl)boronic acid
ADGHSWFUZUADDH-UHFFFAOYSA-N
B(C1=C(N=C(C=C1)OC)OC)(O)O
—
(2,6-dimethoxypyridin-3-yl)boronic Acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.