2-Hydroxyestradiol-d5 is a deuterium-labeled research compound, structurally related to the endogenous estrogen 2-hydroxyestradiol, used primarily in analytical and biochemical studies for tracing metabolic pathways.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 221093-33-0
2-Methoxy-17beta-estradiol-1,4,16,16,17-d5
research reagent
(8R,9S,13S,14S,17S)-16,16,17-Trideuterio-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,4,17-triol
deuterated internal standard
2-{[(4-fluorophenyl)methyl]amino}ethan-1-ol
Research compound
5H-Pyrazolo[4,3-c]pyridine-5-carboxylic acid, 3-amino-2-(4-fluoro-3,5-dimethylphenyl)-2,4,6,7-tetrahydro-4-methyl-, 1,1-dimethylethyl ester, (4S)
research compound
(S)-5-(2,2-DIMETHYLTETRAHYDRO-2H-PYRAN-4-YL)-N-METHYL-N-PHENYL-1H-INDOLE-2-CARBOXAMIDE
research compound
(8R,9S,13S,14S,17S)-1,4,16,16,17-pentadeuterio-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-2,3,17-triol
DILDHNKDVHLEQB-MLEVBVPTSA-N
[2H]C1=C2CC[C@@H]3[C@@H](C2=C(C(=C1O)O)[2H])CC[C@]4([C@H]3CC([C@]4([2H])O)([2H])[2H])C