2,6-Dichlorobenzenesulfonyl chloride is a chemical compound used primarily as a reagent in organic synthesis. It features an aromatic ring substituted with chlorine atoms and a sulfonyl chloride group, contributing to its reactivity in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 6579-54-0
1-ethynyl-4-(trifluoromethyl)benzene
chemical reagent for organic synthesis
(2,6-dimethoxypyridin-3-yl)boronic Acid
chemical reagent for organic synthesis
3-Fluoropyridine
chemical reagent for organic synthesis
4-(Trifluoromethoxy)benzyl Chloride
research compound
4-Nitrophenyl trifluoroacetate
Research reagent for peptide synthesis
Glycyl-L-tyrosine
dipeptide research compound
3,4-Difluorophenylacetic acid
research compound
2,6-dichlorobenzenesulfonyl chloride
WGGKQIKICKLWGN-UHFFFAOYSA-N
C1=CC(=C(C(=C1)Cl)S(=O)(=O)Cl)Cl
—