3-Isopropoxybenzeneboronic acid is a boronic acid derivative used as a research compound. It features an aromatic ring, an ether functional group, and two hydroxyl groups capable of hydrogen bonding.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 216485-86-8
4-(7-methoxyquinolin-4-yl)-2-methylphenol
Toll-like receptor 8 antagonist
(2R,6R)-2,6-dimethylpiperazine
research compound
N-HEXANE-D14
Deuterated solvent for analytical chemistry
Succinic acid-d6
Deuterated internal standard for analytical chemistry
(3-propan-2-yloxyphenyl)boronic acid
UKZVUHVNTYDSOP-UHFFFAOYSA-N
B(C1=CC(=CC=C1)OC(C)C)(O)O
—