This compound is a research reagent featuring a chloromethyl-substituted phenoxyethyl group attached to an azepane ring. It is primarily used as a building block in organic synthesis for the preparation of more complex molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 212771-30-7
1-(2-(4-(chloromethyl)phenoxy)ethyl)azepane hydrochloride
pharmaceutical intermediate
Pyridine-2-carboximidamide hydrochloride
Research compound for chemical synthesis
S-Ethylisothiourea hydrobromide
Research compound for chemical synthesis
2-Nitro-1-phenylpropane
Research compound for chemical synthesis
2-Amino-3,5-dibromopyrazine
Research compound for chemical synthesis
(E)-methyl 4-(dimethylamino)but-2-enoate
research compound
2,3-Difluoro-4-propoxyphenylboronic Acid (contains varying amounts of Anhydride)
Boronic acid research reagent
O-Benzyl-N-((tert-butoxy)carbonyl)-L-tyrosine
research compound for peptide synthesis
1-[2-[4-(chloromethyl)phenoxy]ethyl]azepane
FGCIQSBZGOVNLI-UHFFFAOYSA-N
C1CCCN(CC1)CCOC2=CC=C(C=C2)CCl
—