This compound is a protected derivative of the amino acid tyrosine, where the amino group is blocked by a tert-butoxycarbonyl (Boc) group and the phenolic hydroxyl is protected as a benzyl ether. It is used as a building block in solid-phase peptide synthesis, enabling the selective incorporation of tyrosine derivatives into peptide chains.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
O-Benzyl-N-((tert-butoxy)carbonyl)-L-tyrosine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-(tert-Butoxycarbonyl)-L-phenylalanine
Boc-protected amino acid intermediate
Boc-D-phenylalanine
Protected amino acid for peptide synthesis
Boc-D-Tyr(Et)-OH
protected amino acid building block
2-{2-[3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]acetamido}acetic acid
research compound for peptide synthesis
FMOC-PRO-THR(PSI(ME,ME)PRO)-OH
research compound for peptide synthesis
N-Cbz-N-methyl-L-leucine
research compound for peptide synthesis
N-Cbz-D-Asparagine
research compound for peptide synthesis
3-furancarboxaldehyde, 5-methyl-2-nitro-
Research reagent
O-Benzyl-N-((tert-butoxy)carbonyl)-L-tyrosine(CAS 2130-96-3)의 국제 HS 코드는 2924.29입니다.
2924.29
2924 29 70
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phenylmethoxyphenyl)propanoic acid
ZAVSPTOJKOFMTA-SFHVURJKSA-N
CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)OCC2=CC=CC=C2)C(=O)O
O-Benzyl-N-((tert-butoxy)carbonyl)-L-tyrosine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.