N-Cbz-D-Asparagine is a research compound used in peptide synthesis. It features a benzyloxycarbonyl (Cbz) protecting group attached to the D-asparagine amino acid, making it suitable for solid-phase or solution-phase peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N-Cbz-D-Asparagine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(2R)-2-{[(benzyloxy)carbonyl]amino}butanedioic acid
Peptide synthesis intermediate
N-Carbobenzoxy-L-aspartic acid
peptide synthesis intermediate
3-(3-Pyridyl)alanine
research compound for peptide synthesis
Fmoc-D-Trp-OH
research compound for peptide synthesis
Fmoc-Glu(OtBu)-Gly-OH
research compound for peptide synthesis
Fmoc-asp(otbu)-(dmb)gly-oh
research compound for peptide synthesis
Hexylmagnesium chloride
Grignard reagent for organic synthesis
5-Fluoro-2-nitroanisole
research compound
(2R)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid
FUCKRCGERFLLHP-SECBINFHSA-N
C1=CC=C(C=C1)COC(=O)N[C@H](CC(=O)N)C(=O)O
N-Cbz-D-Asparagine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.