2-Nitro-1-phenylpropane is a research compound used as a reagent in chemical synthesis. Its structure consists of a nitro group attached to a phenylpropane backbone, and it is primarily employed in laboratory-scale reactions and material preparation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Nitro-1-phenylpropane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-(2-(4-(chloromethyl)phenoxy)ethyl)azepane
Research compound for chemical synthesis
Pyridine-2-carboximidamide hydrochloride
Research compound for chemical synthesis
2-Amino-5-bromopyrazine
Research compound for chemical synthesis
S-Ethylisothiourea hydrobromide
Research compound for chemical synthesis
(2R,3R,4R,5R)-2-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-((tert-butyldimethylsilyl)oxy)-5-(5-fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-3-yl (2-cyanoethyl) diisopropylphosphoramidite
Nucleotide phosphoramidite building block
2,6-dimethoxypyridin-4-amine
research compound
Methyl 1H-imidazole-2-carboxylate
Research reagent
(5S)-5-[(2R)-2-[(1R,3aS,4E,7aR)-4-[(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methylideneoxolan-2-one
Vitamin D receptor antagonist research tool
2-nitropropylbenzene
OQBJLKIDAPUHSY-UHFFFAOYSA-N
CC(CC1=CC=CC=C1)[N+](=O)[O-]
2-Nitro-1-phenylpropane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.