2,2'-Dithiodipyridine is a chemical compound consisting of two pyridine rings linked by a disulfide bond. It serves as an oxidizing agent in molecular biology research, commonly used to activate thiol groups or form disulfide bonds in biomolecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2127-03-9
1-(2-(4-(chloromethyl)phenoxy)ethyl)azepane
Research compound for chemical synthesis
(E)-methyl 4-(dimethylamino)but-2-enoate
research compound
2,3-Difluoro-4-propoxyphenylboronic Acid (contains varying amounts of Anhydride)
Boronic acid research reagent
O-Benzyl-N-((tert-butoxy)carbonyl)-L-tyrosine
research compound for peptide synthesis
2-(pyridin-2-yldisulfanyl)pyridine
HAXFWIACAGNFHA-UHFFFAOYSA-N
C1=CC=NC(=C1)SSC2=CC=CC=N2