This compound is a phosphorylated nucleotide derivative used as a pharmaceutical impurity reference standard. It contains an adenine base, a phenoxyphosphoryl group, and an ester moiety, characteristic of its role in analytical quality control for drug manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
6-Methoxyguanine
research compound
Benzo[e]pyrene-d12
Deuterated reference standard for analytical chemistry
2-chloro-4-iodo-6-(trifluoromethyl)pyridine
research compound
3,3',5,5'-Tetraiodothyroformic acid
research compound for thyroid hormone studies
TENOFOVIR ALAFENAMIDE
Active pharmaceutical ingredient
Isopropyl ((r)-((((r)-1-(6-amino-9h-purin-9-yl)propan-2-yl)oxy)methyl)(phenoxy)phosphoryl)-l-alaninate
Nucleotide reverse transcriptase inhibitor prodrug
Tenofovir Alafenamide fumarate
antiviral prodrug for HIV-1
Isopropyl ((s)-((((r)-1-(6-amino-9h-purin-9-yl)propan-2-yl)oxy)methyl)(phenoxy)phosphoryl)-d-alaninate
pharmaceutical impurity standard
propan-2-yl (2R)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate
LDEKQSIMHVQZJK-AAGLAYRLSA-N
C[C@H](CN1C=NC2=C(N=CN=C21)N)OC[P@](=O)(N[C@H](C)C(=O)OC(C)C)OC3=CC=CC=C3
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.