Benzo[e]pyrene-d12 is a deuterated form of benzo[e]pyrene used as a reference standard in analytical chemistry. Its twelve hydrogen atoms are replaced with deuterium, making it valuable for isotope dilution mass spectrometry and other quantitative analysis methods.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 205440-82-0
Benzo[ghi]perylene-d12
Deuterated polycyclic aromatic hydrocarbon standard
Perylene, perdeutero-
deuterated reference standard
2,2,4-Tri(methyl-d3)pentane-1,1,1,3,3,4,5,5,5-d9
Deuterated reference standard for analytical chemistry
2-chloro-4-iodo-6-(trifluoromethyl)pyridine
research compound
3,3',5,5'-Tetraiodothyroformic acid
research compound for thyroid hormone studies
4-((((2-Carboxyethyl)thio)carbonothioyl)thio)-4-cyanopentanoic acid
Chain transfer agent for RAFT polymerization
1-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13-trioxa-4-azahexadecan-16-oic acid
PEG-linked maleimide reagent for conjugation
1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[e]pyrene
TXVHTIQJNYSSKO-AQZSQYOVSA-N
[2H]C1=C(C(=C2C(=C1[2H])C3=C(C(=C(C4=C3C5=C(C(=C(C(=C25)[2H])[2H])[2H])C(=C4[2H])[2H])[2H])[2H])[2H])[2H])[2H]