3-Acetylphenylboronic acid is an organic compound featuring a boronic acid group and an acetyl substituent on a phenyl ring. It is commonly employed as a research reagent, particularly in synthetic chemistry for the formation of carbon-carbon bonds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 204841-19-0
4-Acetylphenylboronic acid
Boronic acid research reagent
2,3-Difluoro-4-propoxyphenylboronic Acid (contains varying amounts of Anhydride)
Boronic acid research reagent
4-Mercaptophenylboronic acid
Boronic acid research reagent
2-Naphthylboronic acid
Boronic acid research reagent
DI-I-PROPYLPHOSPHINE
organophosphorus research reagent
(R)-[(RUCL(H8-BINAP))2(MU-CL)3][NH2ME2]
asymmetric hydrogenation catalyst
Benzo[b]naphtho[1,2-d]furan
diene for Diels-Alder reaction
Cycloocta-1,5-diene;(2S,5S)-1-[2-[(2S,5S)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane;rhodium;tetrafluoroborate
chiral rhodium complex for asymmetric catalysis
(3-acetylphenyl)boronic acid
SJGGDZCTGBKBCK-UHFFFAOYSA-N
B(C1=CC(=CC=C1)C(=O)C)(O)O