4-Acetylphenylboronic acid is a boronic acid derivative featuring an acetyl-substituted aromatic ring. It is commonly used as a research reagent in organic synthesis, particularly in cross-coupling reactions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 149104-90-5
3-Acetylphenylboronic acid
Boronic acid research reagent
B-Hexylboronic acid
Boronic acid research reagent
2-(Trifluoromethoxy)phenylboronic Acid (contains varying amounts of Anhydride)
Boronic acid research reagent
4-Fluorophenylboronic acid
Boronic acid research reagent
(R)-5-Bromo-N-(4-(chlorodifluoromethoxy)phenyl)-6-(3-hydroxypyrrolidin-1-yl)nicotinamide
research compound
6-Nitropyridin-3-amine
Research reagent for hachimoji DNA
트라이플루오로메테인설폰산
catalyst and acid titrant
Arachidonyltrifluoromethane
Phospholipase A2 inhibitor
(4-acetylphenyl)boronic acid
OBQRODBYVNIZJU-UHFFFAOYSA-N
B(C1=CC=C(C=C1)C(=O)C)(O)O