Arachidonyltrifluoromethane (AACOCF3) is a fatty acid derivative and an analog of arachidonic acid. It is primarily used as a research compound that inhibits phospholipase A2, an enzyme involved in lipid metabolism.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Arachidonyltrifluoromethane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-(4-Nitrophenethyl)-3-propylurea
urea derivative for research
Sodium 3-((3-(((2,4-dimethylphenyl)amino)carbonyl)-2-hydroxy-1-naphthyl)azo)-4-hydroxybenzenesulphonate
Colorimetric reagent for magnesium determination
Bis(1,1,1,5,5,5-hexafluoropentane-2,4-dionato-O,O')nickel
research reagent for synthesis
(3-propoxyphenyl)boronic Acid
research compound for organic synthesis
(6Z,9Z,12Z,15Z)-1,1,1-trifluorohenicosa-6,9,12,15-tetraen-2-one
PLWROONZUDKYKG-DOFZRALJSA-N
CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)C(F)(F)F
Arachidonyltrifluoromethane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.