2-Naphthylboronic acid is a boronic acid derivative used as a research reagent. It is commonly employed in organic synthesis and cross-coupling reactions due to its boronic acid functionality, which enables carbon-carbon bond formation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 32316-92-0
2-(Methylsulfonyl)phenylboronic acid
Boronic acid research reagent
4-Ethoxycarbonylphenylboronic acid
Boronic acid research reagent
N-Butylboronic acid
Boronic acid research reagent
Benzylboronic Acid
Boronic acid research reagent
4-Morpholineacetic Acid
Alpha-amino acid research compound
Mca-(Ala7,Lys(Dnp)9)-Bradykinin
fluorescent peptide substrate for enzyme assay
2-(Methylamino)-3-pyridinemethanol
Research compound
6-Fluoroisatin
Research compound
naphthalen-2-ylboronic acid
KPTRDYONBVUWPD-UHFFFAOYSA-N
B(C1=CC2=CC=CC=C2C=C1)(O)O