1-Bromo-9H-carbazole is a research reagent used primarily in carcinogenicity studies. It is classified by the International Agency for Research on Cancer (IARC) as a Group 2B substance, meaning it is possibly carcinogenic to humans based on limited human evidence and sufficient animal evidence.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1-bromo-9H-carbazole 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-iodo-9H-carbazole
research compound
2N,2N-dietil-6-metilpiridin-2,5-diamin dihidroklorid
research compound
Ethyl 3-fluoro-1H-pyrrole-2-carboxylate
research compound
Pneumocandin M1
Micafungin impurity reference standard
1-bromo-9H-carbazole
VCDOOGZTWDOHEB-UHFFFAOYSA-N
C1=CC=C2C(=C1)C3=C(N2)C(=CC=C3)Br
1-bromo-9H-carbazole 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.