3-iodo-9H-carbazole is a halogenated carbazole derivative used primarily as a research compound. Its structure features an iodine atom attached to the carbazole core, giving it utility in organic synthesis and material science studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 16807-13-9
3,6-Diiodo-9H-carbazole
research reagent
2N,2N-dietil-6-metilpiridin-2,5-diamin dihidroklorid
research compound
Ethyl 3-fluoro-1H-pyrrole-2-carboxylate
research compound
Pneumocandin M1
Micafungin impurity reference standard
Bis([3-(4-bromophenyl)-2-(octadec-9-enoylamino)propyl] phosphate);bis([3-(furan-3-yl)-2-(octadec-9-enoylamino)propyl] phosphate);[3-(4-iodophenyl)-2-(octadec-9-enoylamino)propyl] phosphate;bis([2-(octadec-9-enoylamino)-4-phenylbutyl] phosphate)
Research reagent
3-iodo-9H-carbazole
OYIGWMXXIFYAGD-UHFFFAOYSA-N
C1=CC=C2C(=C1)C3=C(N2)C=CC(=C3)I