Pneumocandin M1 is a research reagent used as a Micafungin impurity reference standard. This compound is structurally characterized by a complex cyclic peptide core with multiple hydroxyl and amide groups, making it a highly polar, ring-containing molecule.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Pneumocandin M1 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-[(4R,5R)-4,5-Dihydroxy-N2-(1-oxohexadecyl)-L-ornithine]-4-[(4S)-4-hydroxy-4-[4-hydroxy-3-(sulfooxy)phenyl]-L-threonine]-pneumocandin A0
water-soluble echinocandin intermediate
Bis([3-(4-bromophenyl)-2-(octadec-9-enoylamino)propyl] phosphate);bis([3-(furan-3-yl)-2-(octadec-9-enoylamino)propyl] phosphate);[3-(4-iodophenyl)-2-(octadec-9-enoylamino)propyl] phosphate;bis([2-(octadec-9-enoylamino)-4-phenylbutyl] phosphate)
Research reagent
Fmoc-Val-Thr(Psi(Me,Me)pro)-OH
peptide synthesis research reagent
(3,4-difluorophenyl)boronic acid
Boronic acid synthetic intermediate
N-(5-bromoquinoxalin-6-yl)guanidine
Research compound
ECBN hydrochloride
Echinocandin B nucleus hydrochloride
Caspofungin acetate
active pharmaceutical ingredient
Pneumocandin M1(CAS 168110-44-9)의 국제 HS 코드는 2941.90입니다.
2941.90
2941 90 00
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
[5-[(1S,2S)-2-[(3S,6S,9S,11R,15S,18S,20R,21R,24S,25S,26S)-18-amino-3-[(1R)-3-amino-1-hydroxy-3-oxopropyl]-11,20,21,25-tetrahydroxy-15-[(1R)-1-hydroxyethyl]-26-methyl-2,5,8,14,17,23-hexaoxo-1,4,7,13,16,22-hexazatricyclo[22.3.0.09,13]heptacosan-6-yl]-1,2-dihydroxyethyl]-2-hydroxyphenyl] hydrogen sulfate
QCYMOOBOFFUBHZ-CPYYHODSSA-N
C[C@H]1CN2[C@@H]([C@H]1O)C(=O)N[C@@H]([C@@H](C[C@@H](C(=O)N[C@H](C(=O)N3C[C@@H](C[C@H]3C(=O)N[C@H](C(=O)N[C@H](C2=O)[C@@H](CC(=O)N)O)[C@@H]([C@H](C4=CC(=C(C=C4)O)OS(=O)(=O)O)O)O)O)[C@@H](C)O)N)O)O
Pneumocandin M1 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.