This compound is a chemical compound used as an intermediate in pharmaceutical manufacturing. Its structure features an aromatic ring, an alcohol group, and a halogen, contributing to its utility in stereoselective synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Boc-(2RS,3S)-AHPA
Pharmaceutical intermediate for peptide synthesis
3-tert-Butoxycarbonylamino-2-hydroxy-4-phenylbutyric acid
Boc-protected amino acid intermediate
N-Boc-(2S,3S)-3-amino-2-hydroxy-4-phenyl-butyric acid
Boc-protected amino acid intermediate
N-(methoxycarbonyl)-l-tert-leucine
peptide synthesis intermediate
N2'-Deacetyl-N2'-[4-[[4-[(2,5-dioxo-1-pyrrolidinyl)oxy]-4-oxobutyl]dithio]-4-methyl-1-oxopentyl]maytansine
antibody-drug conjugate linker payload
Tert-butyl 2-((1H-pyrrolo[2,3-b]pyridin-5-yl)oxy)-4-bromobenzoate
pharmaceutical intermediate
1-((4'-Chloro-5,5-dimethyl-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-yl)methyl)piperazine dihydrochloride
pharmaceutical intermediate
1,1-Dimethylethyl N-((1S,2S)-3-chloro-2-hydroxy-1-(phenylmethyl)propyl)carbamate
pharmaceutical intermediate for synthesis
tert-butyl N-[(2S,3R)-4-chloro-3-hydroxy-1-phenylbutan-2-yl]carbamate
GFGQSTIUFXHAJS-STQMWFEESA-N
CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)[C@H](CCl)O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.