This compound is a Boc-protected amino acid intermediate, specifically a derivative of beta-alanine with hydroxy and benzyl substituents. It is used in pharmaceutical manufacturing as a building block for peptide synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 116661-86-0
1,1-Dimethylethyl N-((1S,2R)-3-chloro-2-hydroxy-1-(phenylmethyl)propyl)carbamate
Pharmaceutical intermediate
1,1-Dimethylethyl N-((1S,2S)-3-chloro-2-hydroxy-1-(phenylmethyl)propyl)carbamate
pharmaceutical intermediate for synthesis
N-(tert-Butoxycarbonyl)-L-phenylalanine
Boc-protected amino acid intermediate
3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoic acid
Boc-protected amino acid intermediate
N-boc-2-(indole-3-yl)-dl-glycine
Boc-protected amino acid intermediate
(S)-2-((tert-Butoxycarbonyl)amino)-2-(2-methoxyphenyl)acetic acid
Boc-protected amino acid intermediate
Methyl (3E)-2,3-dihydro-3-(methoxyphenylmethylene)-2-oxo-1H-indole-6-carboxylate
pharmaceutical intermediate
Rac Duloxetine 3-Thiophene IsoMer Oxalate
pharmaceutical intermediate impurity standard
(2S,3S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid
BHTRKISIDQZUQX-RYUDHWBXSA-N
CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)[C@@H](C(=O)O)O