3-Fluoro-5-(trifluoromethyl)benzoic acid is a research compound primarily used in laboratory and manufacturing settings. It is a structurally distinct molecule from flufenamic acid, which is an anthranilic acid derivative and NSAID, but the two share certain structural features.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 161622-05-5
3,5-Bis(trifluoromethyl)benzoic acid
Pharmaceutical intermediate synthesis
4-Bromo-3-(trifluoromethyl)benzoic acid
research compound
(S)-1-BENZYL-PYRROLIDINE-3-CARBOXYLIC ACID
Research chemical
1,3-Dibromobenzene-d4
Deuterated research compound
3,4-Difluorohydrocinnamic acid
research compound
3-fluoro-5-(trifluoromethyl)benzoic acid
NSGKIIGVPBTOBF-UHFFFAOYSA-N
C1=C(C=C(C=C1C(F)(F)F)F)C(=O)O
—