1,3-Dibromobenzene-d4 is a deuterated research compound in which all four hydrogen atoms on the benzene ring are replaced by deuterium. It is primarily used as a stable isotope-labeled reagent in analytical chemistry and organic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1616983-07-3
3,4-Difluorohydrocinnamic acid
research compound
Adenosine, 5'-diphosphoric acid, disodium salt
research reagent for biochemical assays
6-(4-Hydroxyphenoxy)hexyl acrylate
chemical intermediate for research
O-Trifluoromethylpropiophenone
Research chemical for organic synthesis
1,3-DIBROMOBENZENE
chemical intermediate for synthesis
1,3-dibromo-2,4,5,6-tetradeuteriobenzene
JSRLURSZEMLAFO-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1[2H])Br)[2H])Br)[2H]