3,5-Bis(trifluoromethyl)benzoic acid is a chemical compound featuring a benzoic acid core substituted with two trifluoromethyl groups at the 3 and 5 positions. It is primarily used as an intermediate in the synthesis of pharmaceutical compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 725-89-3
3-Fluoro-5-(trifluoromethyl)benzoic acid
research compound
2-Bromo-1,1-dimethoxyethane
Bromoacetaldehyde dimethyl acetal intermediate
6-Methoxypyridazin-3-amine
Pharmaceutical intermediate
2'-Oxo Ifosfamide
Pharmaceutical intermediate for ifosfamide analogs
Ethyl N-(tert-butoxycarbonyl)-L-tyrosinate
protected amino acid intermediate
3,5-bis(trifluoromethyl)benzoic acid
HVFQJWGYVXKLTE-UHFFFAOYSA-N
C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)O