L-Glutamic acid hydrochloride is a salt form of the amino acid glutamic acid, which plays a key role in protein biosynthesis and serves as a major excitatory neurotransmitter in the nervous system. It is primarily used in pharmaceutical manufacturing as a gastric acidifier, and it is also a non-essential nutrient for humans.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 138-15-8
L-glutamic acid
nutritional supplement and flavor enhancer
D-glutamic acid
Nutritional supplement and excitatory neurotransmitter
L-2-Aminoadipic acid
endogenous human metabolite
Aminobenzoate potassium
antifibrotic agent
Momelotinib dihydrochloride
janus kinase inhibitor
Fesoterodinyl (4-Hydroxy-tolterodine phenoxy) Ether
active pharmaceutical ingredient
Gadobutrol
gadolinium-based contrast agent for MRI
MSG monohydrate
flavor enhancer
(2S)-2-aminopentanedioic acid;hydrochloride
RPAJSBKBKSSMLJ-DFWYDOINSA-N
C(CC(=O)O)[C@@H](C(=O)O)N.Cl