This compound is a dithiocarbonate derivative functionalized with a phthalimide group. It is primarily used as a research reagent for chemical synthesis and laboratory investigations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1334418-35-7
((2R)-2-Acetyloxy-4-hydroxy-4-oxobutyl)-dimethyl-(trideuteriomethyl)azanium chloride
isotope-labeled research compound
(R)-Propionyl Carnitine-d3 Chloride
deuterated research compound
Butyryl-L-carnitine-d3 (chloride)
isotopically labeled research compound
Octanoyl L-Carnitine-d3 Chloride
isotopically labeled research standard
O-[2-(1,3-dioxoisoindol-2-yl)ethyl] methylsulfanylmethanethioate
RQPULIGANVLCDP-UHFFFAOYSA-N
CSC(=S)OCCN1C(=O)C2=CC=CC=C2C1=O
—