Alpha-Benzyloxycarbonylamino-24(ethylene glycol)-omega-propionic acid is a PEGylated linker compound featuring a benzyloxycarbonyl (Cbz) protecting group at one terminus and a propionic acid group at the other. It is primarily used as a research reagent for bioconjugation and surface modification applications due to its flexible polyethylene glycol (PEG) spacer and terminal functional groups.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1334177-88-6
[2-(2-Hydroxy-ethoxy)-ethyl]-carbamic acid benzyl ester
n.a
O-2-(1,3-Dioxoisoindolin-2-yl)ethyl S-methyl carbonodithioate
research compound
((2R)-2-Acetyloxy-4-hydroxy-4-oxobutyl)-dimethyl-(trideuteriomethyl)azanium chloride
isotope-labeled research compound
(R)-Propionyl Carnitine-d3 Chloride
deuterated research compound
Butyryl-L-carnitine-d3 (chloride)
isotopically labeled research compound
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
WVKANAHNXOWXKU-UHFFFAOYSA-N
C1=CC=C(C=C1)COC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O
—