Z-Leu-leu-leu-al (N-benzoxycarbonyl-L-leucyl-L-leucyl-L-leucinal) is a tripeptide aldehyde compound primarily used as a research reagent in proteasome inhibition studies. Its structure features three leucine residues, an aldehyde group, and a benzyloxycarbonyl protecting group, contributing to its role as a laboratory tool for investigating protein degradation pathways.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 133407-82-6
1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13,16,19,22-hexaoxa-4-azapentacosan-25-oic acid
PEGylated maleimide linker for conjugation
1-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13,16,19,22,25,28-octaoxa-4-azahentriacontan-31-oic acid
PEG-linked maleimide bioconjugation reagent
Alpha-Benzyloxycarbonylamino-24(ethylene glycol)-omega-propionic acid
PEGylated linker compound
O-2-(1,3-Dioxoisoindolin-2-yl)ethyl S-methyl carbonodithioate
research compound
benzyl N-[(2S)-4-methyl-1-[[(2S)-4-methyl-1-[[(2S)-4-methyl-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]carbamate
TZYWCYJVHRLUCT-VABKMULXSA-N
CC(C)C[C@@H](C=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)OCC1=CC=CC=C1