Z-Leu-leu-leu-al (N-benzoxycarbonyl-L-leucyl-L-leucyl-L-leucinal) is a tripeptide aldehyde compound primarily used as a research reagent in proteasome inhibition studies. Its structure features three leucine residues, an aldehyde group, and a benzyloxycarbonyl protecting group, contributing to its role as a laboratory tool for investigating protein degradation pathways.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Z-Leu-leu-leu-al 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13,16,19,22-hexaoxa-4-azapentacosan-25-oic acid
PEGylated maleimide linker for conjugation
1-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13,16,19,22,25,28-octaoxa-4-azahentriacontan-31-oic acid
PEG-linked maleimide bioconjugation reagent
Alpha-Benzyloxycarbonylamino-24(ethylene glycol)-omega-propionic acid
PEGylated linker compound
O-2-(1,3-Dioxoisoindolin-2-yl)ethyl S-methyl carbonodithioate
research compound
Z-Leu-leu-leu-al(CAS 133407-82-6)의 국제 HS 코드는 2924.29입니다.
2924.29
2924 29 70
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
benzyl N-[(2S)-4-methyl-1-[[(2S)-4-methyl-1-[[(2S)-4-methyl-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]carbamate
TZYWCYJVHRLUCT-VABKMULXSA-N
CC(C)C[C@@H](C=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)OCC1=CC=CC=C1
Z-Leu-leu-leu-al 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.