4-Aminocarbonylphenylboronic acid is a boronic acid derivative containing an amide functional group and an aromatic ring. It is primarily used as a research reagent in boron chemistry and related synthetic applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Aminocarbonylphenylboronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(S)-3-([1,1'-biphenyl]-4-yl)-2-amino-2-methylpropanoic acid
research compound
(S)-2-Amino-2-methylpent-4-ynoic acid
Research compound
EthaniMidaMide, N-(4-broMo-2,6-difluorophenyl)-N'-(1-Methylethyl)-
research compound
(S)-GLYCIDOXY-T-BUTYLDIMETHYLSILANE
Research reagent for organic synthesis
(4-carbamoylphenyl)boronic acid
GNRHNKBJNUVWFZ-UHFFFAOYSA-N
B(C1=CC=C(C=C1)C(=O)N)(O)O
4-Aminocarbonylphenylboronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.