This compound is a research reagent featuring a biphenyl-substituted alanine structure. It contains both an amino group and a carboxylic acid group, along with two aromatic rings, and is used in laboratory studies to investigate expanded genetic code systems.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(S)-3-([1,1'-biphenyl]-4-yl)-2-amino-2-methylpropanoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
ALPHA-METHYL-D-PHENYLALANINE
building block for peptide synthesis
Alpha-methyl-L-phenylalanine
research compound
(S)-2-Amino-2-methylpent-4-ynoic acid
Research compound
EthaniMidaMide, N-(4-broMo-2,6-difluorophenyl)-N'-(1-Methylethyl)-
research compound
(S)-GLYCIDOXY-T-BUTYLDIMETHYLSILANE
Research reagent for organic synthesis
1-(3-bromophenyl)-3,5-diphenylbenzene
research compound
(R)-3-([1,1'-Biphenyl]-4-yl)-2-amino-2-methylpropanoic acid
n.a
(2S)-2-amino-2-methyl-3-(4-phenylphenyl)propanoic acid
KGPOAGRUGOUXOK-INIZCTEOSA-N
C[C@](CC1=CC=C(C=C1)C2=CC=CC=C2)(C(=O)O)N
(S)-3-([1,1'-biphenyl]-4-yl)-2-amino-2-methylpropanoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.