This compound is a research reagent featuring an aromatic ring with bromine and fluorine substituents. It is primarily used in laboratory settings for chemical and biological studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1231930-29-2
(S)-GLYCIDOXY-T-BUTYLDIMETHYLSILANE
Research reagent for organic synthesis
1-(3-bromophenyl)-3,5-diphenylbenzene
research compound
4-tert-Butylphenylboronic acid
organic synthesis building block
1-Hydroxybenzotriazole hydrate
Reagent in synthetic organic chemistry
N-(4-bromo-2,6-difluorophenyl)-N'-propan-2-ylethanimidamide
SCDDZPXMZYLKLU-UHFFFAOYSA-N
CC(C)N=C(C)NC1=C(C=C(C=C1F)Br)F