This compound is a polychlorinated biphenyl derivative featuring a fully deuterium-labeled phenyl ring and a deuterium-labeled cyclohexadiene ring containing two chlorine substituents. It is a highly specific isotopically labeled research compound used in analytical and environmental studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1219804-50-8
Acamprosate-d12 Calcium (dipropyl-d12)
isotopically labeled research compound
L-Methionine-d3
isotopically labeled research compound
Rac Ambrisentan-d3 Methyl Ester
isotopically labeled research compound
Butyryl-L-carnitine-d3 (chloride)
isotopically labeled research compound
2,4,5-trichloroaniline-d4
deuterated analytical reference standard
2,4-Difluorobenzoic Acid-d3
deuterated research compound
2-phenoxyethyl-1,1,2,2-d4 alcohol
deuterated research reference standard
4-N-Butylanisole-2,3,5,6-d4
deuterated research compound
3,6-dichloro-1,2,3,4,6-pentadeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)cyclohexa-1,4-diene
KQVWSTQXDLZRRK-YINOKFNYSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(C(=C(C2([2H])Cl)[2H])[2H])([2H])Cl)[2H])[2H])[2H]
—