2,4-Difluorobenzoic Acid-d3 is a deuterium-labeled research compound with three hydrogen atoms replaced by deuterium. It is used as a stable isotope internal standard in analytical chemistry and metabolic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1219804-63-3
2-phenoxyethyl-1,1,2,2-d4 alcohol
deuterated research reference standard
4-N-Butylanisole-2,3,5,6-d4
deuterated research compound
4-Fluorophenol-d5
deuterated research compound
MIANSERIN-D3 HCL
deuterated labeling reagent for mass spectrometry
2,4-Difluorobenzoic acid
Pharmaceutical intermediate for synthesis
Benzoic acid, 2,4-difluoro-, ion(1-)
Pharmaceutical intermediate
2,3,5-trideuterio-4,6-difluorobenzoic acid
NJYBIFYEWYWYAN-CBYSEHNBSA-N
[2H]C1=C(C(=C(C(=C1C(=O)O)F)[2H])F)[2H]