This compound is a chemical compound featuring an aromatic ring with two fluorine substituents and a carboxylate group. It is primarily used as an intermediate in the synthesis of various pharmaceutical compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 83198-07-6
3,5-Dimethylisoxazole-4-boronic acid pinacol ester
pharmaceutical intermediate
2-(3-(Carboxymethyl)-4-(phenylthio)phenyl)propanoic acid
Zatoprofen intermediate anti-inflammatory
Ethyl 4-(((1R)-2-(5-(2-fluoro-3-methoxyphenyl)-3-(2-fluoro-6-(trifluoromethyl)benzyl)-4-methyl-2,6-dioxo-3,6-dihydro-1(2H)-pyrimidinyl)-1-phenylethyl)amino)butanoate
Elagolix intermediate
(1R,5S)-8-Benzyl-8-azabicyclo(3.2.1)octan-3-one hydrochloride
pharmaceutical intermediate
2,4-Difluorobenzoic Acid-d3
deuterated research compound
2,4-Difluorobenzoic acid
Pharmaceutical intermediate for synthesis
2,4-difluorobenzoate
NJYBIFYEWYWYAN-UHFFFAOYSA-M
C1=CC(=C(C=C1F)F)C(=O)[O-]