Illudin S is a naturally occurring sesquiterpene compound found in certain poisonous mushrooms. It is primarily used as a research compound due to its unique molecular structure and biological activity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Illudin S 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-Succinimidyl-3'-pyrenebutyrate
Fluorescent labeling reagent
Benzyltrimethylammonium dichloroiodate
Phase transfer catalyst
2-Propenoic acid, 2-methyl-, 1-(1-methylethyl)cyclopentyl ester
research compound
Triethyl orthopropionate
Organic synthesis reagent
Illudin M
research compound
(1R,2S,5R)-1,5-dihydroxy-2-(hydroxymethyl)-2,5,7-trimethylspiro[1H-indene-6,1'-cyclopropane]-4-one
DDLLIYKVDWPHJI-RDBSUJKOSA-N
CC1=C2[C@H]([C@](C=C2C(=O)[C@](C13CC3)(C)O)(C)CO)O
Illudin S 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.