This compound is a chemical compound used primarily as a research reagent. It features an ester functional group and a cyclopentane ring, with a LogP of approximately 3.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1149760-04-2
1-isopropylcyclohexyl Methacrylate
monomer for polymer synthesis
Triethyl orthopropionate
Organic synthesis reagent
Glycidic acid
inhibitor of glycolate synthesis
2-Fluoro-3-(trifluoromethyl)benzoic acid
Research compound for Hammett equation studies
Ethyl 2-phenyl-2-((phenylcarbonothioyl)thio)acetate
Research reagent for RAFT polymerization
(1-propan-2-ylcyclopentyl) 2-methylprop-2-enoate
GPXHHBYETPIZOU-UHFFFAOYSA-N
CC(C)C1(CCCC1)OC(=O)C(=C)C
—