2-Fluoro-3-(trifluoromethyl)benzoic acid is a substituted benzoic acid derivative used in physical organic chemistry as a model compound for Hammett equation studies. Its structure, featuring both fluoro and trifluoromethyl substituents on the aromatic ring, makes it suitable for investigating the influence of electron-withdrawing groups on reaction rates and equilibria.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 115029-22-6
Ethyl 2-phenyl-2-((phenylcarbonothioyl)thio)acetate
Research reagent for RAFT polymerization
3-Nitroaniline-2,4,5,6-d4
deuterated research compound
2-nitrotoluene-3,4,5,6-d4
deuterated research compound
2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine
Boronic acid ester for cross-coupling
2-fluoro-3-(trifluoromethyl)benzoic acid
XVEAMDNSCPPPCP-UHFFFAOYSA-N
C1=CC(=C(C(=C1)C(F)(F)F)F)C(=O)O
—