2-Nitrotoluene-3,4,5,6-d4 is a deuterated research compound, specifically a tetradeuterated derivative of 2-nitrotoluene where four hydrogen atoms on the aromatic ring are replaced with deuterium. Its primary significance lies in its use as a labeled compound for analytical and research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-nitrotoluene-3,4,5,6-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine
Boronic acid ester for cross-coupling
1,8-diethyl-1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indole
research compound
N-Succinimidyl 4-(2-pyridyldithio)butanoate
heterobifunctional crosslinker for conjugation
D-Luciferin potassium salt
bioluminescence assay reagent
2-Nitrotoluene
Production of dyes and rubber chemicals
1,2,3,4-tetradeuterio-5-methyl-6-nitrobenzene
PLAZTCDQAHEYBI-QFFDRWTDSA-N
[2H]C1=C(C(=C(C(=C1[2H])C)[N+](=O)[O-])[2H])[2H]
2-nitrotoluene-3,4,5,6-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.