1-Succinimidyl-3'-pyrenebutyrate is a fluorescent labeling reagent. It consists of a pyrene fluorophore linked to an N-hydroxysuccinimide (NHS) ester reactive group, enabling covalent attachment to primary amines on biomolecules such as proteins or peptides.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 114932-60-4
Benzyltrimethylammonium dichloroiodate
Phase transfer catalyst
2-Propenoic acid, 2-methyl-, 1-(1-methylethyl)cyclopentyl ester
research compound
Triethyl orthopropionate
Organic synthesis reagent
Glycidic acid
inhibitor of glycolate synthesis
(2,5-dioxopyrrolidin-1-yl) 4-pyren-1-ylbutanoate
YBNMDCCMCLUHBL-UHFFFAOYSA-N
C1CC(=O)N(C1=O)OC(=O)CCCC2=C3C=CC4=CC=CC5=C4C3=C(C=C5)C=C2