(R)-2-Methyl-CBS-oxazaborolidine is a chiral oxazaborolidine compound used as an asymmetric reduction catalyst in organic synthesis. It is characterized by a heterocyclic structure containing boron and nitrogen atoms, with diphenyl substituents.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 112022-83-0
UNA 2-OBz U amidite
Oligonucleotide synthesis phosphoramidite reagent
(2R)-2-(6-Benzamido-9H-purin-9-yl)-2-(((2R)-1-(bis(4-methoxyphenyl)(phenyl)methoxy)-3-(((2-cyanoethoxy)(diisopropylamino)phosphino)oxy)propan-2-yl)oxy)ethyl benzoate
oligonucleotide synthesis phosphoramidite reagent
UNA-C(Ac)-CE Phosphoramidite
Oligonucleotide synthesis phosphoramidite reagent
Deoxycholic-2,2,4,4-D4 acid
Deuterated analytical reference standard
(3aS)-1-methyl-3,3-diphenyl-hexahydropyrrolo[1,2-c][1,3,2]oxazaborole
asymmetric reduction catalyst
(3aR)-1-methyl-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole
VMKAFJQFKBASMU-QGZVFWFLSA-N
B1(N2CCC[C@@H]2C(O1)(C3=CC=CC=C3)C4=CC=CC=C4)C