This compound is a phosphoramidite reagent designed for oligonucleotide synthesis, specifically incorporating a UNA (unlocked nucleic acid) monomer with a 2-O-benzoyl uridine modification. Its complex structure, featuring multiple aromatic rings and functional groups, highlights its role as a specialized building block in nucleic acid chemistry research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
UNA 2-OBz U amidite 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
UNA-C(Ac)-CE Phosphoramidite
Oligonucleotide synthesis phosphoramidite reagent
(2R)-2-(6-Benzamido-9H-purin-9-yl)-2-(((2R)-1-(bis(4-methoxyphenyl)(phenyl)methoxy)-3-(((2-cyanoethoxy)(diisopropylamino)phosphino)oxy)propan-2-yl)oxy)ethyl benzoate
oligonucleotide synthesis phosphoramidite reagent
Deoxycholic-2,2,4,4-D4 acid
Deuterated analytical reference standard
3-Hydroxy-2-methylpyridine
research compound
Dicyclopropyl ketone
research reagent
[(2R)-2-[(2R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropan-2-yl]oxy-2-(2,4-dioxopyrimidin-1-yl)ethyl] benzoate
MHRGEJFLFYZLJI-LZOZAVILSA-N
CC(C)N(C(C)C)P(OCCC#N)OC[C@@H](COC(C1=CC=CC=C1)(C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC)O[C@H](COC(=O)C4=CC=CC=C4)N5C=CC(=O)NC5=O
UNA 2-OBz U amidite 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.