This compound is a research reagent used in oligonucleotide synthesis, specifically as a phosphoramidite building block. It features a complex, flexible structure with multiple aromatic rings and protecting groups designed for automated DNA/RNA assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1120329-52-3
(2R)-2-(((2R)-1-(Bis(4-methoxyphenyl)(phenyl)methoxy)-3-(((2-cyanoethoxy)(diisopropylamino)phosphino)oxy)propan-2-yl)oxy)-2-(2-isobutyramido-6-oxo-3H-purin-9(6H)-yl)ethyl benzoate
nucleoside phosphoramidite building block
(S)-GNA-A(Bz)-phosphoramidite
Pharmaceutical intermediate for oligonucleotide synthesis
MMT-Hexylaminolinker Phosphoramidite
oligonucleotide synthesis phosphoramidite reagent
UNA-C(Ac)-CE Phosphoramidite
Oligonucleotide synthesis phosphoramidite reagent
Deoxycholic-2,2,4,4-D4 acid
Deuterated analytical reference standard
3-Hydroxy-2-methylpyridine
research compound
Dicyclopropyl ketone
research reagent
[(2R)-2-(6-benzamidopurin-9-yl)-2-[(2R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropan-2-yl]oxyethyl] benzoate
DETQAICZNNZAEM-OWWCMFKUSA-N
CC(C)N(C(C)C)P(OCCC#N)OC[C@@H](COC(C1=CC=CC=C1)(C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC)O[C@H](COC(=O)C4=CC=CC=C4)N5C=NC6=C(N=CN=C65)NC(=O)C7=CC=CC=C7