Tyr-Ile-Gly-Ser-Arg (YIGSR) is a synthetic pentapeptide derived from the laminin molecule and is used as a research reagent. It corresponds to a sequence within the laminin β1 chain and is commonly employed in cell adhesion and migration studies due to its high polarity and multiple hydrogen-bond donors.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Tyr-ile-gly-ser-arg 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Morpholine-d8 Hydrochloride
deuterated solvent reference standard
Spacer Phosphoramidite C3
oligonucleotide synthesis reagent
(1R,2R)-2-[[bis(trideuteriomethyl)amino]methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrochloride
isotope-labeled reference standard
Potassium (R)-3-hydroxybutanoate
research chemical
(2S)-2-[[(2S)-2-[[2-[[(2S,3S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]acetyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid
MWOGMBZGFFZBMK-LJZWMIMPSA-N
CC[C@H](C)[C@@H](C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)NC(=O)[C@H](CC1=CC=C(C=C1)O)N
Tyr-ile-gly-ser-arg 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.