This compound is an Fmoc-protected, N-methylated derivative of L-leucine, used as a building block in solid-phase peptide synthesis. Its structure incorporates a fluorenylmethoxycarbonyl (Fmoc) group for temporary protection of the amino function, enabling the sequential assembly of peptides.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-((9H-Fluoren-9-ylmethoxy)carbonyl)-N-methyl-L-alanine
Peptide synthesis building block
N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N-methyl-L-isoleucine
Fmoc-protected amino acid for peptide synthesis
FMoc-alpha-Me-D-Phe(2-F)-OH
Fmoc-protected amino acid for peptide synthesis
Fmoc-N-(2,4-dimethoxybenzyl)-Gly-OH
Fmoc-protected amino acid for peptide synthesis
Fmoc-L-Propargylglycine
Fmoc-protected amino acid for peptide synthesis
2-Amino-4-(4-methylpiperazin-1-yl) benzoic acid tertbutyl ester
Pharmaceutical intermediate
4-(4-Methylpiperazin-1-yl)-2-(2,2,2-trifluoro-N-(tetrahydro-2H-pyran-4-yl)acetamido)benzoic acid 2,2,2-trifluoroacetate
pharmaceutical intermediate
Benzyl (1-(hydroxymethyl)cyclopropyl)carbamate
peptide synthesis protecting reagent
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-methylpentanoic acid
BUJQSIPFDWLNDC-FQEVSTJZSA-N
CC(C)C[C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.