This compound is a building block for peptide synthesis, specifically the N-methylated alanine derivative protected with a fluorenylmethoxycarbonyl (Fmoc) group. It is used as a pharmaceutical intermediate in the production of peptides for research and manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N-((9H-Fluoren-9-ylmethoxy)carbonyl)-N-methyl-L-alanine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}(methyl)amino)-3-methylbutanoic acid
amino acid protecting reagent
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}(methyl)amino)-4-methylpentanoic acid
Fmoc-protected amino acid for peptide synthesis
N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N-methyl-D-leucine
Fmoc-protected amino acid for peptide synthesis
(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanoic acid
Peptide synthesis building block
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanine
Peptide synthesis building block
2-({[(9H-FLUOREN-9-YL)METHOXY]CARBONYL}(METHYL)AMINO)ACETIC ACID
Peptide synthesis building block
Fmoc-Lys(Boc)-Ser(Psi(Me,Me)pro)-OH
Peptide synthesis building block
Chitosan, 2-hydroxypropyl ether
pharmaceutical excipient raw material
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid
JOFHWKQIQLPZTC-LBPRGKRZSA-N
C[C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
N-((9H-Fluoren-9-ylmethoxy)carbonyl)-N-methyl-L-alanine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.